About [(2R)-2-methylmorpholin-2-yl] 4-benzylbenzoate
[(2R)-2-methylmorpholin-2-yl] 4-benzylbenzoate (PubChem CID 174297863) has the molecular formula C19H21NO3
and a molecular weight of 311.38 g/mol. Its IUPAC name is [(2R)-2-methylmorpholin-2-yl] 4-benzylbenzoate.
Molecular Properties
| Compound Name | [(2R)-2-methylmorpholin-2-yl] 4-benzylbenzoate |
| PubChem CID | 174297863 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [(2R)-2-methylmorpholin-2-yl] 4-benzylbenzoate |
| SMILES | C[C@@]1(OC(=O)c2ccc(Cc3ccccc3)cc2)CNCCO1 |
| InChI | InChI=1S/C19H21NO3/c1-19(14-20-11-12-22-19)23-18(21)17-9-7-16(8-10-17)13-15-5-3-2-4-6-15/h2-10,20H,11-14H2,1H3/t19-/m1/s1 |
| InChIKey | MXRYNGKDDAJOIX-LJQANCHMSA-N |
| XLogP | 2.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R)-2-methylmorpholin-2-yl] 4-benzylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-methylmorpholin-2-yl] 4-benzylbenzoate?
The IUPAC name of [(2R)-2-methylmorpholin-2-yl] 4-benzylbenzoate (CID 174297863) is [(2R)-2-methylmorpholin-2-yl] 4-benzylbenzoate.
What is the SMILES notation for [(2R)-2-methylmorpholin-2-yl] 4-benzylbenzoate?
The canonical SMILES for [(2R)-2-methylmorpholin-2-yl] 4-benzylbenzoate is C[C@@]1(OC(=O)c2ccc(Cc3ccccc3)cc2)CNCCO1.
What is the InChIKey of [(2R)-2-methylmorpholin-2-yl] 4-benzylbenzoate?
The InChIKey is MXRYNGKDDAJOIX-LJQANCHMSA-N. The full InChI is InChI=1S/C19H21NO3/c1-19(14-20-11-12-22-19)23-18(21)17-9-7-16(8-10-17)13-15-5-3-2-4-6-15/h2-10,20H,11-14H2,1H3/t19-/m1/s1.
What are the key properties of [(2R)-2-methylmorpholin-2-yl] 4-benzylbenzoate?
[(2R)-2-methylmorpholin-2-yl] 4-benzylbenzoate has a molecular weight of 311.38 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-methylmorpholin-2-yl] 4-benzylbenzoate is sourced from PubChem (CID 174297863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).