About diethoxy(oxo)phosphanium;1-N-methyl-4-nitronaphthalene-1,2-diamine
diethoxy(oxo)phosphanium;1-N-methyl-4-nitronaphthalene-1,2-diamine (PubChem CID 174299484) has the molecular formula C15H21N3O5P+
and a molecular weight of 354.32 g/mol. Its IUPAC name is diethoxy(oxo)phosphanium;1-N-methyl-4-nitronaphthalene-1,2-diamine.
Molecular Properties
| Compound Name | diethoxy(oxo)phosphanium;1-N-methyl-4-nitronaphthalene-1,2-diamine |
| PubChem CID | 174299484 |
| Molecular Formula | C15H21N3O5P+ |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | diethoxy(oxo)phosphanium;1-N-methyl-4-nitronaphthalene-1,2-diamine |
| SMILES | CCO[P+](=O)OCC.CNc1c(N)cc([N+](=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C11H11N3O2.C4H10O3P/c1-13-11-8-5-3-2-4-7(8)10(14(15)16)6-9(11)12;1-3-6-8(5)7-4-2/h2-6,13H,12H2,1H3;3-4H2,1-2H3/q;+1 |
| InChIKey | DUCXWSANPFMBFE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethoxy(oxo)phosphanium;1-N-methyl-4-nitronaphthalene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy(oxo)phosphanium;1-N-methyl-4-nitronaphthalene-1,2-diamine?
The IUPAC name of diethoxy(oxo)phosphanium;1-N-methyl-4-nitronaphthalene-1,2-diamine (CID 174299484) is diethoxy(oxo)phosphanium;1-N-methyl-4-nitronaphthalene-1,2-diamine.
What is the SMILES notation for diethoxy(oxo)phosphanium;1-N-methyl-4-nitronaphthalene-1,2-diamine?
The canonical SMILES for diethoxy(oxo)phosphanium;1-N-methyl-4-nitronaphthalene-1,2-diamine is CCO[P+](=O)OCC.CNc1c(N)cc([N+](=O)[O-])c2ccccc12.
What is the InChIKey of diethoxy(oxo)phosphanium;1-N-methyl-4-nitronaphthalene-1,2-diamine?
The InChIKey is DUCXWSANPFMBFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O2.C4H10O3P/c1-13-11-8-5-3-2-4-7(8)10(14(15)16)6-9(11)12;1-3-6-8(5)7-4-2/h2-6,13H,12H2,1H3;3-4H2,1-2H3/q;+1.
What are the key properties of diethoxy(oxo)phosphanium;1-N-methyl-4-nitronaphthalene-1,2-diamine?
diethoxy(oxo)phosphanium;1-N-methyl-4-nitronaphthalene-1,2-diamine has a molecular weight of 354.32 g/mol, XLogP of 4.09, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy(oxo)phosphanium;1-N-methyl-4-nitronaphthalene-1,2-diamine is sourced from PubChem (CID 174299484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).