C13H16N3O5P — CID 19706681
1-[(2-amino-4-nitronaphthalen-1-yl)amino]propylphosphonic acid (PubChem CID 19706681) has the molecular formula C13H16N3O5P and a molecular weight of 325.26 g/mol. Its IUPAC name is 1-[(2-amino-4-nitronaphthalen-1-yl)amino]propylphosphonic acid.
| Compound Name | 1-[(2-amino-4-nitronaphthalen-1-yl)amino]propylphosphonic acid |
|---|---|
| PubChem CID | 19706681 |
| Molecular Formula | C13H16N3O5P |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 1-[(2-amino-4-nitronaphthalen-1-yl)amino]propylphosphonic acid |
| SMILES | CCC(Nc1c(N)cc([N+](=O)[O-])c2ccccc12)P(=O)(O)O |
| InChI | InChI=1S/C13H16N3O5P/c1-2-12(22(19,20)21)15-13-9-6-4-3-5-8(9)11(16(17)18)7-10(13)14/h3-7,12,15H,2,14H2,1H3,(H2,19,20,21) |
| InChIKey | VRGODKQHFSVAMV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|