About N-(4-chlorophenyl)-2,4-dinitronaphthalen-1-amine
N-(4-chlorophenyl)-2,4-dinitronaphthalen-1-amine (PubChem CID 2849337) has the molecular formula C16H10ClN3O4
and a molecular weight of 343.73 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2,4-dinitronaphthalen-1-amine.
Molecular Properties
| Compound Name | N-(4-chlorophenyl)-2,4-dinitronaphthalen-1-amine |
| PubChem CID | 2849337 |
| Molecular Formula | C16H10ClN3O4 |
| Molecular Weight | 343.73 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | N-(4-chlorophenyl)-2,4-dinitronaphthalen-1-amine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2ccccc2c1Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H10ClN3O4/c17-10-5-7-11(8-6-10)18-16-13-4-2-1-3-12(13)14(19(21)22)9-15(16)20(23)24/h1-9,18H |
| InChIKey | VQRAACBAPSPIKS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.73 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-chlorophenyl)-2,4-dinitronaphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenyl)-2,4-dinitronaphthalen-1-amine?
The IUPAC name of N-(4-chlorophenyl)-2,4-dinitronaphthalen-1-amine (CID 2849337) is N-(4-chlorophenyl)-2,4-dinitronaphthalen-1-amine.
What is the SMILES notation for N-(4-chlorophenyl)-2,4-dinitronaphthalen-1-amine?
The canonical SMILES for N-(4-chlorophenyl)-2,4-dinitronaphthalen-1-amine is O=[N+]([O-])c1cc([N+](=O)[O-])c2ccccc2c1Nc1ccc(Cl)cc1.
What is the InChIKey of N-(4-chlorophenyl)-2,4-dinitronaphthalen-1-amine?
The InChIKey is VQRAACBAPSPIKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClN3O4/c17-10-5-7-11(8-6-10)18-16-13-4-2-1-3-12(13)14(19(21)22)9-15(16)20(23)24/h1-9,18H.
What are the key properties of N-(4-chlorophenyl)-2,4-dinitronaphthalen-1-amine?
N-(4-chlorophenyl)-2,4-dinitronaphthalen-1-amine has a molecular weight of 343.73 g/mol, XLogP of 5.05, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenyl)-2,4-dinitronaphthalen-1-amine is sourced from PubChem (CID 2849337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).