C18H9N5O4 — CID 20567274
4-[(2,4-dinitronaphthalen-1-yl)amino]benzene-1,3-dicarbonitrile (PubChem CID 20567274) has the molecular formula C18H9N5O4 and a molecular weight of 359.30 g/mol. Its IUPAC name is 4-[(2,4-dinitronaphthalen-1-yl)amino]benzene-1,3-dicarbonitrile.
| Compound Name | 4-[(2,4-dinitronaphthalen-1-yl)amino]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 20567274 |
| Molecular Formula | C18H9N5O4 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 4-[(2,4-dinitronaphthalen-1-yl)amino]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1ccc(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])c3ccccc23)c(C#N)c1 |
| InChI | InChI=1S/C18H9N5O4/c19-9-11-5-6-15(12(7-11)10-20)21-18-14-4-2-1-3-13(14)16(22(24)25)8-17(18)23(26)27/h1-8,21H |
| InChIKey | YIWHXHOTSBWVRT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 145.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|