C21H29N2O4S- — CID 174300316
cyclopropyl-[8-[(1-ethylpyrrolidin-2-yl)methylcarbamoyl]-3,4-dihydro-2H-chromen-6-yl]methanesulfinate (PubChem CID 174300316) has the molecular formula C21H29N2O4S- and a molecular weight of 405.54 g/mol. Its IUPAC name is cyclopropyl-[8-[(1-ethylpyrrolidin-2-yl)methylcarbamoyl]-3,4-dihydro-2H-chromen-6-yl]methanesulfinate.
| Compound Name | cyclopropyl-[8-[(1-ethylpyrrolidin-2-yl)methylcarbamoyl]-3,4-dihydro-2H-chromen-6-yl]methanesulfinate |
|---|---|
| PubChem CID | 174300316 |
| Molecular Formula | C21H29N2O4S- |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | cyclopropyl-[8-[(1-ethylpyrrolidin-2-yl)methylcarbamoyl]-3,4-dihydro-2H-chromen-6-yl]methanesulfinate |
| SMILES | CCN1CCCC1CNC(=O)c1cc(C(C2CC2)S(=O)[O-])cc2c1OCCC2 |
| InChI | InChI=1S/C21H30N2O4S/c1-2-23-9-3-6-17(23)13-22-21(24)18-12-16(20(28(25)26)14-7-8-14)11-15-5-4-10-27-19(15)18/h11-12,14,17,20H,2-10,13H2,1H3,(H,22,24)(H,25,26)/p-1 |
| InChIKey | QIZHDTPGHCGEHE-UHFFFAOYSA-M |
| XLogP | 2.56 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|