C15H13ClN2O5S — CID 174302581
[4-(3-carbamoyl-5-cyclopropyl-1,2-oxazole-4-carbonyl)-3-chlorophenyl]methanesulfinic acid (PubChem CID 174302581) has the molecular formula C15H13ClN2O5S and a molecular weight of 368.80 g/mol. Its IUPAC name is [4-(3-carbamoyl-5-cyclopropyl-1,2-oxazole-4-carbonyl)-3-chlorophenyl]methanesulfinic acid.
| Compound Name | [4-(3-carbamoyl-5-cyclopropyl-1,2-oxazole-4-carbonyl)-3-chlorophenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174302581 |
| Molecular Formula | C15H13ClN2O5S |
| Molecular Weight | 368.80 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | [4-(3-carbamoyl-5-cyclopropyl-1,2-oxazole-4-carbonyl)-3-chlorophenyl]methanesulfinic acid |
| SMILES | NC(=O)c1noc(C2CC2)c1C(=O)c1ccc(CS(=O)O)cc1Cl |
| InChI | InChI=1S/C15H13ClN2O5S/c16-10-5-7(6-24(21)22)1-4-9(10)13(19)11-12(15(17)20)18-23-14(11)8-2-3-8/h1,4-5,8H,2-3,6H2,(H2,17,20)(H,21,22) |
| InChIKey | SABLTILLYNMXQV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.80 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|