C16H16Br2 — CID 174303175
3,6-dibromo-2,9,9-trimethyl-2,3-dihydrofluorene (PubChem CID 174303175) has the molecular formula C16H16Br2 and a molecular weight of 368.11 g/mol. Its IUPAC name is 3,6-dibromo-2,9,9-trimethyl-2,3-dihydrofluorene.
| Compound Name | 3,6-dibromo-2,9,9-trimethyl-2,3-dihydrofluorene |
|---|---|
| PubChem CID | 174303175 |
| Molecular Formula | C16H16Br2 |
| Molecular Weight | 368.11 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | 3,6-dibromo-2,9,9-trimethyl-2,3-dihydrofluorene |
| SMILES | CC1C=C2C(=CC1Br)c1cc(Br)ccc1C2(C)C |
| InChI | InChI=1S/C16H16Br2/c1-9-6-14-12(8-15(9)18)11-7-10(17)4-5-13(11)16(14,2)3/h4-9,15H,1-3H3 |
| InChIKey | IVPCQFVMFFYLGX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.11 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|