C27H34N7O5S+ — CID 174309788
(2S)-3-[[(1R)-1-[3-(1H-imidazol-2-ylamino)propyl]-1-methylindazol-1-ium-5-carbonyl]amino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid (PubChem CID 174309788) has the molecular formula C27H34N7O5S+ and a molecular weight of 568.68 g/mol. Its IUPAC name is (2S)-3-[[(1R)-1-[3-(1H-imidazol-2-ylamino)propyl]-1-methylindazol-1-ium-5-carbonyl]amino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-3-[[(1R)-1-[3-(1H-imidazol-2-ylamino)propyl]-1-methylindazol-1-ium-5-carbonyl]amino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 174309788 |
| Molecular Formula | C27H34N7O5S+ |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | (2S)-3-[[(1R)-1-[3-(1H-imidazol-2-ylamino)propyl]-1-methylindazol-1-ium-5-carbonyl]amino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)N[C@@H](CNC(=O)c2ccc3c(c2)C=N[N@+]3(C)CCCNc2ncc[nH]2)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C27H33N7O5S/c1-17-12-18(2)24(19(3)13-17)40(38,39)33-22(26(36)37)16-31-25(35)20-6-7-23-21(14-20)15-32-34(23,4)11-5-8-28-27-29-9-10-30-27/h6-7,9-10,12-15,22,33H,5,8,11,16H2,1-4H3,(H3-,28,29,30,31,35,36,37)/p+1/t22-,34+/m0/s1 |
| InChIKey | JMYIERKBTARNDF-XSJBNIOMSA-O |
| XLogP | 2.28 |
| TPSA | 165.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|