About acetonitrile;4-chloroaniline
acetonitrile;4-chloroaniline (PubChem CID 174309916) has the molecular formula C8H9ClN2
and a molecular weight of 168.63 g/mol. Its IUPAC name is acetonitrile;4-chloroaniline.
Molecular Properties
| Compound Name | acetonitrile;4-chloroaniline |
| PubChem CID | 174309916 |
| Molecular Formula | C8H9ClN2 |
| Molecular Weight | 168.63 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | acetonitrile;4-chloroaniline |
| SMILES | CC#N.Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C6H6ClN.C2H3N/c7-5-1-3-6(8)4-2-5;1-2-3/h1-4H,8H2;1H3 |
| InChIKey | JOIDXMNKWXEBNR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.63 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;4-chloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;4-chloroaniline?
The IUPAC name of acetonitrile;4-chloroaniline (CID 174309916) is acetonitrile;4-chloroaniline.
What is the SMILES notation for acetonitrile;4-chloroaniline?
The canonical SMILES for acetonitrile;4-chloroaniline is CC#N.Nc1ccc(Cl)cc1.
What is the InChIKey of acetonitrile;4-chloroaniline?
The InChIKey is JOIDXMNKWXEBNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN.C2H3N/c7-5-1-3-6(8)4-2-5;1-2-3/h1-4H,8H2;1H3.
What are the key properties of acetonitrile;4-chloroaniline?
acetonitrile;4-chloroaniline has a molecular weight of 168.63 g/mol, XLogP of 2.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;4-chloroaniline is sourced from PubChem (CID 174309916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).