C20H31FN2S — CID 174310042
2-[(E)-6-fluoro-6-methyl-1-[[(2Z)-2-methylsulfanylpenta-2,4-dienyl]amino]hept-3-en-3-yl]cyclohexa-1,3-dien-1-amine (PubChem CID 174310042) has the molecular formula C20H31FN2S and a molecular weight of 350.55 g/mol. Its IUPAC name is 2-[(E)-6-fluoro-6-methyl-1-[[(2Z)-2-methylsulfanylpenta-2,4-dienyl]amino]hept-3-en-3-yl]cyclohexa-1,3-dien-1-amine.
| Compound Name | 2-[(E)-6-fluoro-6-methyl-1-[[(2Z)-2-methylsulfanylpenta-2,4-dienyl]amino]hept-3-en-3-yl]cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 174310042 |
| Molecular Formula | C20H31FN2S |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 2-[(E)-6-fluoro-6-methyl-1-[[(2Z)-2-methylsulfanylpenta-2,4-dienyl]amino]hept-3-en-3-yl]cyclohexa-1,3-dien-1-amine |
| SMILES | C=C/C=C(/CNCC/C(=C\CC(C)(C)F)C1=C(N)CCC=C1)SC |
| InChI | InChI=1S/C20H31FN2S/c1-5-8-17(24-4)15-23-14-12-16(11-13-20(2,3)21)18-9-6-7-10-19(18)22/h5-6,8-9,11,23H,1,7,10,12-15,22H2,2-4H3/b16-11+,17-8- |
| InChIKey | BCJJKTNHUSJXLC-MTMUIEQKSA-N |
| XLogP | 5.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|