C14H10BrFNO4S- — CID 174310300
[3-bromo-6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2-fluorophenyl]methanesulfinate (PubChem CID 174310300) has the molecular formula C14H10BrFNO4S- and a molecular weight of 387.21 g/mol. Its IUPAC name is [3-bromo-6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2-fluorophenyl]methanesulfinate.
| Compound Name | [3-bromo-6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2-fluorophenyl]methanesulfinate |
|---|---|
| PubChem CID | 174310300 |
| Molecular Formula | C14H10BrFNO4S- |
| Molecular Weight | 387.21 g/mol |
| Exact Mass | 385.95 |
| IUPAC Name | [3-bromo-6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2-fluorophenyl]methanesulfinate |
| SMILES | O=C(c1cnoc1C1CC1)c1ccc(Br)c(F)c1CS(=O)[O-] |
| InChI | InChI=1S/C14H11BrFNO4S/c15-11-4-3-8(10(12(11)16)6-22(19)20)13(18)9-5-17-21-14(9)7-1-2-7/h3-5,7H,1-2,6H2,(H,19,20)/p-1 |
| InChIKey | YNWOCNFKBMBHJA-UHFFFAOYSA-M |
| XLogP | 3.06 |
| TPSA | 83.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|