C16H14NO6S- — CID 174267589
[6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-dihydro-1,4-benzodioxin-5-yl]methanesulfinate (PubChem CID 174267589) has the molecular formula C16H14NO6S- and a molecular weight of 348.36 g/mol. Its IUPAC name is [6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-dihydro-1,4-benzodioxin-5-yl]methanesulfinate.
| Compound Name | [6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-dihydro-1,4-benzodioxin-5-yl]methanesulfinate |
|---|---|
| PubChem CID | 174267589 |
| Molecular Formula | C16H14NO6S- |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | [6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-2,3-dihydro-1,4-benzodioxin-5-yl]methanesulfinate |
| SMILES | O=C(c1cnoc1C1CC1)c1ccc2c(c1CS(=O)[O-])OCCO2 |
| InChI | InChI=1S/C16H15NO6S/c18-14(11-7-17-23-15(11)9-1-2-9)10-3-4-13-16(22-6-5-21-13)12(10)8-24(19)20/h3-4,7,9H,1-2,5-6,8H2,(H,19,20)/p-1 |
| InChIKey | DAXGVKRBGUHGMF-UHFFFAOYSA-M |
| XLogP | 1.93 |
| TPSA | 101.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|