C16H16NO7S2- — CID 174288290
2-[2-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-5-methylsulfonylphenyl]ethyl sulfite (PubChem CID 174288290) has the molecular formula C16H16NO7S2- and a molecular weight of 398.44 g/mol. Its IUPAC name is 2-[2-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-5-methylsulfonylphenyl]ethyl sulfite.
| Compound Name | 2-[2-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-5-methylsulfonylphenyl]ethyl sulfite |
|---|---|
| PubChem CID | 174288290 |
| Molecular Formula | C16H16NO7S2- |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 2-[2-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-5-methylsulfonylphenyl]ethyl sulfite |
| SMILES | CS(=O)(=O)c1ccc(C(=O)c2cnoc2C2CC2)c(CCOS(=O)[O-])c1 |
| InChI | InChI=1S/C16H17NO7S2/c1-26(21,22)12-4-5-13(11(8-12)6-7-23-25(19)20)15(18)14-9-17-24-16(14)10-2-3-10/h4-5,8-10H,2-3,6-7H2,1H3,(H,19,20)/p-1 |
| InChIKey | ITMIJCRDTCWGPQ-UHFFFAOYSA-M |
| XLogP | 1.54 |
| TPSA | 126.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|