C15H11F3NO5S- — CID 174323356
[2-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-5-(trifluoromethyl)phenyl]methyl sulfite (PubChem CID 174323356) has the molecular formula C15H11F3NO5S- and a molecular weight of 374.32 g/mol. Its IUPAC name is [2-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-5-(trifluoromethyl)phenyl]methyl sulfite.
| Compound Name | [2-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-5-(trifluoromethyl)phenyl]methyl sulfite |
|---|---|
| PubChem CID | 174323356 |
| Molecular Formula | C15H11F3NO5S- |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | [2-(5-cyclopropyl-1,2-oxazole-4-carbonyl)-5-(trifluoromethyl)phenyl]methyl sulfite |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1COS(=O)[O-])c1cnoc1C1CC1 |
| InChI | InChI=1S/C15H12F3NO5S/c16-15(17,18)10-3-4-11(9(5-10)7-23-25(21)22)13(20)12-6-19-24-14(12)8-1-2-8/h3-6,8H,1-2,7H2,(H,21,22)/p-1 |
| InChIKey | CHIMSTQEKXPCOE-UHFFFAOYSA-M |
| XLogP | 3.11 |
| TPSA | 92.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|