C25H29N5O4 — CID 174312846
tert-butyl N-[5-[2-[2-methoxy-4-(1-methylpyrazol-4-yl)phenyl]prop-2-enoylamino]-6-methyl-3-pyridinyl]carbamate (PubChem CID 174312846) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is tert-butyl N-[5-[2-[2-methoxy-4-(1-methylpyrazol-4-yl)phenyl]prop-2-enoylamino]-6-methyl-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-[2-[2-methoxy-4-(1-methylpyrazol-4-yl)phenyl]prop-2-enoylamino]-6-methyl-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 174312846 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | tert-butyl N-[5-[2-[2-methoxy-4-(1-methylpyrazol-4-yl)phenyl]prop-2-enoylamino]-6-methyl-3-pyridinyl]carbamate |
| SMILES | C=C(C(=O)Nc1cc(NC(=O)OC(C)(C)C)cnc1C)c1ccc(-c2cnn(C)c2)cc1OC |
| InChI | InChI=1S/C25H29N5O4/c1-15(20-9-8-17(10-22(20)33-7)18-12-27-30(6)14-18)23(31)29-21-11-19(13-26-16(21)2)28-24(32)34-25(3,4)5/h8-14H,1H2,2-7H3,(H,28,32)(H,29,31) |
| InChIKey | QVOXOFSOGALAHD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|