C24H31N5O4 — CID 175984305
tert-butyl N-[3-(5-hydroxypentyl)-5-[5-(1-methylpyrazol-4-yl)pyrimidin-2-yl]oxyphenyl]carbamate (PubChem CID 175984305) has the molecular formula C24H31N5O4 and a molecular weight of 453.54 g/mol. Its IUPAC name is tert-butyl N-[3-(5-hydroxypentyl)-5-[5-(1-methylpyrazol-4-yl)pyrimidin-2-yl]oxyphenyl]carbamate.
| Compound Name | tert-butyl N-[3-(5-hydroxypentyl)-5-[5-(1-methylpyrazol-4-yl)pyrimidin-2-yl]oxyphenyl]carbamate |
|---|---|
| PubChem CID | 175984305 |
| Molecular Formula | C24H31N5O4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | tert-butyl N-[3-(5-hydroxypentyl)-5-[5-(1-methylpyrazol-4-yl)pyrimidin-2-yl]oxyphenyl]carbamate |
| SMILES | Cn1cc(-c2cnc(Oc3cc(CCCCCO)cc(NC(=O)OC(C)(C)C)c3)nc2)cn1 |
| InChI | InChI=1S/C24H31N5O4/c1-24(2,3)33-23(31)28-20-10-17(8-6-5-7-9-30)11-21(12-20)32-22-25-13-18(14-26-22)19-15-27-29(4)16-19/h10-16,30H,5-9H2,1-4H3,(H,28,31) |
| InChIKey | GRNYZEVSGTXADJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|