C21H27NO4 — CID 139940090
tert-butyl N-[4-[[3-(3-hydroxypropyl)phenyl]methoxy]phenyl]carbamate (PubChem CID 139940090) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is tert-butyl N-[4-[[3-(3-hydroxypropyl)phenyl]methoxy]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[3-(3-hydroxypropyl)phenyl]methoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 139940090 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | tert-butyl N-[4-[[3-(3-hydroxypropyl)phenyl]methoxy]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(OCc2cccc(CCCO)c2)cc1 |
| InChI | InChI=1S/C21H27NO4/c1-21(2,3)26-20(24)22-18-9-11-19(12-10-18)25-15-17-7-4-6-16(14-17)8-5-13-23/h4,6-7,9-12,14,23H,5,8,13,15H2,1-3H3,(H,22,24) |
| InChIKey | YSIWDCAUQAWKLT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |