(5-benzoyloxy-2,2-dimethylcyclopentyl)methanesulfinic acid

C15H20O4S — CID 174314961

IUPAC(5-benzoyloxy-2,2-dimethylcyclopentyl)methanesulfinic acid
SMILESCC1(C)CCC(OC(=O)c2ccccc2)C1CS(=O)O
InChIInChI=1S/C15H20O4S/c1-15(2)9-8-13(12(15)10-20(17)18)19-14(16)11-6-4-3-5-7-11/h3-7,12-13H,8-10H2,1-2H3,(H,17,18)
InChIKeyXIHHBVZEJSMQGA-UHFFFAOYSA-N
MW296.39 g/mol
LogP2.87
Rot. Bonds4

About (5-benzoyloxy-2,2-dimethylcyclopentyl)methanesulfinic acid

(5-benzoyloxy-2,2-dimethylcyclopentyl)methanesulfinic acid (PubChem CID 174314961) has the molecular formula C15H20O4S and a molecular weight of 296.39 g/mol. Its IUPAC name is (5-benzoyloxy-2,2-dimethylcyclopentyl)methanesulfinic acid.

Molecular Properties

Compound Name(5-benzoyloxy-2,2-dimethylcyclopentyl)methanesulfinic acid
PubChem CID174314961
Molecular FormulaC15H20O4S
Molecular Weight296.39 g/mol
Exact Mass296.11
IUPAC Name(5-benzoyloxy-2,2-dimethylcyclopentyl)methanesulfinic acid
SMILESCC1(C)CCC(OC(=O)c2ccccc2)C1CS(=O)O
InChIInChI=1S/C15H20O4S/c1-15(2)9-8-13(12(15)10-20(17)18)19-14(16)11-6-4-3-5-7-11/h3-7,12-13H,8-10H2,1-2H3,(H,17,18)
InChIKeyXIHHBVZEJSMQGA-UHFFFAOYSA-N
XLogP2.87
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.39
LogP ≤ 52.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze (5-benzoyloxy-2,2-dimethylcyclopentyl)methanesulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-benzoyloxy-2,2-dimethylcyclopentyl)methanesulfinic acid?
The IUPAC name of (5-benzoyloxy-2,2-dimethylcyclopentyl)methanesulfinic acid (CID 174314961) is (5-benzoyloxy-2,2-dimethylcyclopentyl)methanesulfinic acid.
What is the SMILES notation for (5-benzoyloxy-2,2-dimethylcyclopentyl)methanesulfinic acid?
The canonical SMILES for (5-benzoyloxy-2,2-dimethylcyclopentyl)methanesulfinic acid is CC1(C)CCC(OC(=O)c2ccccc2)C1CS(=O)O.
What is the InChIKey of (5-benzoyloxy-2,2-dimethylcyclopentyl)methanesulfinic acid?
The InChIKey is XIHHBVZEJSMQGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4S/c1-15(2)9-8-13(12(15)10-20(17)18)19-14(16)11-6-4-3-5-7-11/h3-7,12-13H,8-10H2,1-2H3,(H,17,18).
What are the key properties of (5-benzoyloxy-2,2-dimethylcyclopentyl)methanesulfinic acid?
(5-benzoyloxy-2,2-dimethylcyclopentyl)methanesulfinic acid has a molecular weight of 296.39 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-benzoyloxy-2,2-dimethylcyclopentyl)methanesulfinic acid is sourced from PubChem (CID 174314961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).