C21H21N3O2 — CID 174315282
10-[(1Z,3E)-1-(dimethylamino)hexa-1,3,5-trien-3-yl]-9-hydroxy-7-methyl-6H-benzo[f][1,7]naphthyridin-5-one (PubChem CID 174315282) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 10-[(1Z,3E)-1-(dimethylamino)hexa-1,3,5-trien-3-yl]-9-hydroxy-7-methyl-6H-benzo[f][1,7]naphthyridin-5-one.
| Compound Name | 10-[(1Z,3E)-1-(dimethylamino)hexa-1,3,5-trien-3-yl]-9-hydroxy-7-methyl-6H-benzo[f][1,7]naphthyridin-5-one |
|---|---|
| PubChem CID | 174315282 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 10-[(1Z,3E)-1-(dimethylamino)hexa-1,3,5-trien-3-yl]-9-hydroxy-7-methyl-6H-benzo[f][1,7]naphthyridin-5-one |
| SMILES | C=C/C=C(\C=C/N(C)C)c1c(O)cc(C)c2[nH]c(=O)c3ncccc3c12 |
| InChI | InChI=1S/C21H21N3O2/c1-5-7-14(9-11-24(3)4)17-16(25)12-13(2)19-18(17)15-8-6-10-22-20(15)21(26)23-19/h5-12,25H,1H2,2-4H3,(H,23,26)/b11-9-,14-7+ |
| InChIKey | KZBMUYLMXBOTPL-WEAPMHCESA-N |
| XLogP | 3.74 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|