C21H20N4O2 — CID 171549631
10-[5-(1-aminopropan-2-yl)-2-pyridinyl]-9-hydroxy-7-methyl-6H-benzo[h][1,6]naphthyridin-5-one (PubChem CID 171549631) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 10-[5-(1-aminopropan-2-yl)-2-pyridinyl]-9-hydroxy-7-methyl-6H-benzo[h][1,6]naphthyridin-5-one.
| Compound Name | 10-[5-(1-aminopropan-2-yl)-2-pyridinyl]-9-hydroxy-7-methyl-6H-benzo[h][1,6]naphthyridin-5-one |
|---|---|
| PubChem CID | 171549631 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 10-[5-(1-aminopropan-2-yl)-2-pyridinyl]-9-hydroxy-7-methyl-6H-benzo[h][1,6]naphthyridin-5-one |
| SMILES | Cc1cc(O)c(-c2ccc(C(C)CN)cn2)c2c1[nH]c(=O)c1cccnc12 |
| InChI | InChI=1S/C21H20N4O2/c1-11-8-16(26)17(15-6-5-13(10-24-15)12(2)9-22)18-19(11)25-21(27)14-4-3-7-23-20(14)18/h3-8,10,12,26H,9,22H2,1-2H3,(H,25,27) |
| InChIKey | AZQOKEYSDQOKFN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|