C21H20N4O2 — CID 171549742
10-[4-(1-aminopropan-2-yl)phenyl]-7-methyl-6,8-dihydropyrido[4,3-c][1,7]naphthyridine-5,9-dione (PubChem CID 171549742) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 10-[4-(1-aminopropan-2-yl)phenyl]-7-methyl-6,8-dihydropyrido[4,3-c][1,7]naphthyridine-5,9-dione.
| Compound Name | 10-[4-(1-aminopropan-2-yl)phenyl]-7-methyl-6,8-dihydropyrido[4,3-c][1,7]naphthyridine-5,9-dione |
|---|---|
| PubChem CID | 171549742 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 10-[4-(1-aminopropan-2-yl)phenyl]-7-methyl-6,8-dihydropyrido[4,3-c][1,7]naphthyridine-5,9-dione |
| SMILES | Cc1[nH]c(=O)c(-c2ccc(C(C)CN)cc2)c2c1[nH]c(=O)c1ccncc12 |
| InChI | InChI=1S/C21H20N4O2/c1-11(9-22)13-3-5-14(6-4-13)17-18-16-10-23-8-7-15(16)20(26)25-19(18)12(2)24-21(17)27/h3-8,10-11H,9,22H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | HSBGLJJYYPGABN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|