C23H23N3O2 — CID 171549666
1-[4-(1-aminopropan-2-yl)phenyl]-7-hydroxy-2,4-dimethyl-5H-benzo[c][1,7]naphthyridin-6-one (PubChem CID 171549666) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 1-[4-(1-aminopropan-2-yl)phenyl]-7-hydroxy-2,4-dimethyl-5H-benzo[c][1,7]naphthyridin-6-one.
| Compound Name | 1-[4-(1-aminopropan-2-yl)phenyl]-7-hydroxy-2,4-dimethyl-5H-benzo[c][1,7]naphthyridin-6-one |
|---|---|
| PubChem CID | 171549666 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-[4-(1-aminopropan-2-yl)phenyl]-7-hydroxy-2,4-dimethyl-5H-benzo[c][1,7]naphthyridin-6-one |
| SMILES | Cc1nc(C)c2[nH]c(=O)c3c(O)cccc3c2c1-c1ccc(C(C)CN)cc1 |
| InChI | InChI=1S/C23H23N3O2/c1-12(11-24)15-7-9-16(10-8-15)19-13(2)25-14(3)22-21(19)17-5-4-6-18(27)20(17)23(28)26-22/h4-10,12,27H,11,24H2,1-3H3,(H,26,28) |
| InChIKey | WGNWEWXVAGIRBO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|