C56H55NO — CID 174315756
7-tert-butyl-N-[2-(6,8-dimethyldibenzofuran-4-yl)-5-methylphenyl]-9,9-dimethyl-N-(4,9,9-trimethyl-3,4-dihydrofluoren-2-yl)fluoren-2-amine (PubChem CID 174315756) has the molecular formula C56H55NO and a molecular weight of 758.06 g/mol. Its IUPAC name is 7-tert-butyl-N-[2-(6,8-dimethyldibenzofuran-4-yl)-5-methylphenyl]-9,9-dimethyl-N-(4,9,9-trimethyl-3,4-dihydrofluoren-2-yl)fluoren-2-amine.
| Compound Name | 7-tert-butyl-N-[2-(6,8-dimethyldibenzofuran-4-yl)-5-methylphenyl]-9,9-dimethyl-N-(4,9,9-trimethyl-3,4-dihydrofluoren-2-yl)fluoren-2-amine |
|---|---|
| PubChem CID | 174315756 |
| Molecular Formula | C56H55NO |
| Molecular Weight | 758.06 g/mol |
| Exact Mass | 757.43 |
| IUPAC Name | 7-tert-butyl-N-[2-(6,8-dimethyldibenzofuran-4-yl)-5-methylphenyl]-9,9-dimethyl-N-(4,9,9-trimethyl-3,4-dihydrofluoren-2-yl)fluoren-2-amine |
| SMILES | Cc1ccc(-c2cccc3c2oc2c(C)cc(C)cc23)c(N(C2=CC3=C(c4ccccc4C3(C)C)C(C)C2)c2ccc3c(c2)C(C)(C)c2cc(C(C)(C)C)ccc2-3)c1 |
| InChI | InChI=1S/C56H55NO/c1-32-19-22-41(42-16-14-17-43-45-26-33(2)25-35(4)52(45)58-53(42)43)50(27-32)57(38-28-34(3)51-44-15-12-13-18-46(44)55(8,9)49(51)31-38)37-21-24-40-39-23-20-36(54(5,6)7)29-47(39)56(10,11)48(40)30-37/h12-27,29-31,34H,28H2,1-11H3 |
| InChIKey | YEUBTAAGWMTBKL-UHFFFAOYSA-N |
| XLogP | 15.59 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.06 |
| LogP ≤ 5 | 15.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |