About 3-phenylprop-2-enyl 2-(propanoylamino)benzoate
3-phenylprop-2-enyl 2-(propanoylamino)benzoate (PubChem CID 174317231) has the molecular formula C19H19NO3
and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-phenylprop-2-enyl 2-(propanoylamino)benzoate.
Molecular Properties
| Compound Name | 3-phenylprop-2-enyl 2-(propanoylamino)benzoate |
| PubChem CID | 174317231 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 3-phenylprop-2-enyl 2-(propanoylamino)benzoate |
| SMILES | CCC(=O)Nc1ccccc1C(=O)OCC=Cc1ccccc1 |
| InChI | InChI=1S/C19H19NO3/c1-2-18(21)20-17-13-7-6-12-16(17)19(22)23-14-8-11-15-9-4-3-5-10-15/h3-13H,2,14H2,1H3,(H,20,21) |
| InChIKey | JSABSVDGJWHZQJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-phenylprop-2-enyl 2-(propanoylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylprop-2-enyl 2-(propanoylamino)benzoate?
The IUPAC name of 3-phenylprop-2-enyl 2-(propanoylamino)benzoate (CID 174317231) is 3-phenylprop-2-enyl 2-(propanoylamino)benzoate.
What is the SMILES notation for 3-phenylprop-2-enyl 2-(propanoylamino)benzoate?
The canonical SMILES for 3-phenylprop-2-enyl 2-(propanoylamino)benzoate is CCC(=O)Nc1ccccc1C(=O)OCC=Cc1ccccc1.
What is the InChIKey of 3-phenylprop-2-enyl 2-(propanoylamino)benzoate?
The InChIKey is JSABSVDGJWHZQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO3/c1-2-18(21)20-17-13-7-6-12-16(17)19(22)23-14-8-11-15-9-4-3-5-10-15/h3-13H,2,14H2,1H3,(H,20,21).
What are the key properties of 3-phenylprop-2-enyl 2-(propanoylamino)benzoate?
3-phenylprop-2-enyl 2-(propanoylamino)benzoate has a molecular weight of 309.37 g/mol, XLogP of 3.91, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylprop-2-enyl 2-(propanoylamino)benzoate is sourced from PubChem (CID 174317231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).