C14H14O2P+ — CID 174317927
1,1-diphenylethyl-hydroxy-oxophosphanium (PubChem CID 174317927) has the molecular formula C14H14O2P+ and a molecular weight of 245.24 g/mol. Its IUPAC name is 1,1-diphenylethyl-hydroxy-oxophosphanium.
| Compound Name | 1,1-diphenylethyl-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 174317927 |
| Molecular Formula | C14H14O2P+ |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1,1-diphenylethyl-hydroxy-oxophosphanium |
| SMILES | CC(c1ccccc1)(c1ccccc1)[P+](=O)O |
| InChI | InChI=1S/C14H13O2P/c1-14(17(15)16,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3/p+1 |
| InChIKey | YCBFZJMOWMCVHZ-UHFFFAOYSA-O |
| XLogP | 3.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|