About [3-[cyano(phenyl)methoxy]phenyl] 2-methylbutaneperoxoate
[3-[cyano(phenyl)methoxy]phenyl] 2-methylbutaneperoxoate (PubChem CID 174319030) has the molecular formula C19H19NO4
and a molecular weight of 325.36 g/mol. Its IUPAC name is [3-[cyano(phenyl)methoxy]phenyl] 2-methylbutaneperoxoate.
Molecular Properties
| Compound Name | [3-[cyano(phenyl)methoxy]phenyl] 2-methylbutaneperoxoate |
| PubChem CID | 174319030 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [3-[cyano(phenyl)methoxy]phenyl] 2-methylbutaneperoxoate |
| SMILES | CCC(C)C(=O)OOc1cccc(OC(C#N)c2ccccc2)c1 |
| InChI | InChI=1S/C19H19NO4/c1-3-14(2)19(21)24-23-17-11-7-10-16(12-17)22-18(13-20)15-8-5-4-6-9-15/h4-12,14,18H,3H2,1-2H3 |
| InChIKey | UBBJRBNOACWXEL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [3-[cyano(phenyl)methoxy]phenyl] 2-methylbutaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[cyano(phenyl)methoxy]phenyl] 2-methylbutaneperoxoate?
The IUPAC name of [3-[cyano(phenyl)methoxy]phenyl] 2-methylbutaneperoxoate (CID 174319030) is [3-[cyano(phenyl)methoxy]phenyl] 2-methylbutaneperoxoate.
What is the SMILES notation for [3-[cyano(phenyl)methoxy]phenyl] 2-methylbutaneperoxoate?
The canonical SMILES for [3-[cyano(phenyl)methoxy]phenyl] 2-methylbutaneperoxoate is CCC(C)C(=O)OOc1cccc(OC(C#N)c2ccccc2)c1.
What is the InChIKey of [3-[cyano(phenyl)methoxy]phenyl] 2-methylbutaneperoxoate?
The InChIKey is UBBJRBNOACWXEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO4/c1-3-14(2)19(21)24-23-17-11-7-10-16(12-17)22-18(13-20)15-8-5-4-6-9-15/h4-12,14,18H,3H2,1-2H3.
What are the key properties of [3-[cyano(phenyl)methoxy]phenyl] 2-methylbutaneperoxoate?
[3-[cyano(phenyl)methoxy]phenyl] 2-methylbutaneperoxoate has a molecular weight of 325.36 g/mol, XLogP of 4.21, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[cyano(phenyl)methoxy]phenyl] 2-methylbutaneperoxoate is sourced from PubChem (CID 174319030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).