C38H45N7O4S — CID 174321158
2-[2-[3-[4-(ethylsulfanylamino)-2-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenoxy]phenoxy]ethyl-methylamino]-N-(2,2,4,4-tetramethylcyclobutyl)pyrimidine-5-carboxamide (PubChem CID 174321158) has the molecular formula C38H45N7O4S and a molecular weight of 695.89 g/mol. Its IUPAC name is 2-[2-[3-[4-(ethylsulfanylamino)-2-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenoxy]phenoxy]ethyl-methylamino]-N-(2,2,4,4-tetramethylcyclobutyl)pyrimidine-5-carboxamide.
| Compound Name | 2-[2-[3-[4-(ethylsulfanylamino)-2-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenoxy]phenoxy]ethyl-methylamino]-N-(2,2,4,4-tetramethylcyclobutyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 174321158 |
| Molecular Formula | C38H45N7O4S |
| Molecular Weight | 695.89 g/mol |
| Exact Mass | 695.33 |
| IUPAC Name | 2-[2-[3-[4-(ethylsulfanylamino)-2-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenoxy]phenoxy]ethyl-methylamino]-N-(2,2,4,4-tetramethylcyclobutyl)pyrimidine-5-carboxamide |
| SMILES | CCSNc1ccc(Oc2cccc(OCCN(C)c3ncc(C(=O)NC4C(C)(C)CC4(C)C)cn3)c2)c(-c2cn(C)c(=O)c3[nH]ccc23)c1 |
| InChI | InChI=1S/C38H45N7O4S/c1-8-50-43-25-12-13-31(29(18-25)30-22-45(7)34(47)32-28(30)14-15-39-32)49-27-11-9-10-26(19-27)48-17-16-44(6)36-40-20-24(21-41-36)33(46)42-35-37(2,3)23-38(35,4)5/h9-15,18-22,35,39,43H,8,16-17,23H2,1-7H3,(H,42,46) |
| InChIKey | LDNOKLQXDKOLLF-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.89 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|