C12H21N3O3 — CID 174321199
tert-butyl (5S)-2-(cyanoamino)-5-(methoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 174321199) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is tert-butyl (5S)-2-(cyanoamino)-5-(methoxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (5S)-2-(cyanoamino)-5-(methoxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 174321199 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | tert-butyl (5S)-2-(cyanoamino)-5-(methoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | COC[C@@H]1CCC(NC#N)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21N3O3/c1-12(2,3)18-11(16)15-9(7-17-4)5-6-10(15)14-8-13/h9-10,14H,5-7H2,1-4H3/t9-,10?/m0/s1 |
| InChIKey | AOGHMRRCAXXUKB-RGURZIINSA-N |
| XLogP | 1.43 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|