C7H13N3O2 — CID 174322105
2-[(2S)-4-hydroxybutan-2-yl]-1,3-dihydro-1,2,4-triazole-3-carbaldehyde (PubChem CID 174322105) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-[(2S)-4-hydroxybutan-2-yl]-1,3-dihydro-1,2,4-triazole-3-carbaldehyde.
| Compound Name | 2-[(2S)-4-hydroxybutan-2-yl]-1,3-dihydro-1,2,4-triazole-3-carbaldehyde |
|---|---|
| PubChem CID | 174322105 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 2-[(2S)-4-hydroxybutan-2-yl]-1,3-dihydro-1,2,4-triazole-3-carbaldehyde |
| SMILES | C[C@@H](CCO)N1NC=NC1C=O |
| InChI | InChI=1S/C7H13N3O2/c1-6(2-3-11)10-7(4-12)8-5-9-10/h4-7,11H,2-3H2,1H3,(H,8,9)/t6-,7?/m0/s1 |
| InChIKey | OOKICBPRPJHUTJ-PKPIPKONSA-N |
| XLogP | -0.87 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|