C7H12N2O — CID 123134984
2-propan-2-yl-3,4-dihydropyrazole-4-carbaldehyde (PubChem CID 123134984) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 2-propan-2-yl-3,4-dihydropyrazole-4-carbaldehyde.
| Compound Name | 2-propan-2-yl-3,4-dihydropyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 123134984 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 2-propan-2-yl-3,4-dihydropyrazole-4-carbaldehyde |
| SMILES | CC(C)N1CC(C=O)C=N1 |
| InChI | InChI=1S/C7H12N2O/c1-6(2)9-4-7(5-10)3-8-9/h3,5-7H,4H2,1-2H3 |
| InChIKey | SCXYGNKJDHZYHP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|