About 3-propan-2-yl-3,4-diazabicyclo[4.1.0]hept-4-en-2-one
3-propan-2-yl-3,4-diazabicyclo[4.1.0]hept-4-en-2-one (PubChem CID 68715981) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 3-propan-2-yl-3,4-diazabicyclo[4.1.0]hept-4-en-2-one.
Analyze 3-propan-2-yl-3,4-diazabicyclo[4.1.0]hept-4-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-3,4-diazabicyclo[4.1.0]hept-4-en-2-one?
The IUPAC name of 3-propan-2-yl-3,4-diazabicyclo[4.1.0]hept-4-en-2-one (CID 68715981) is 3-propan-2-yl-3,4-diazabicyclo[4.1.0]hept-4-en-2-one.
What is the SMILES notation for 3-propan-2-yl-3,4-diazabicyclo[4.1.0]hept-4-en-2-one?
The canonical SMILES for 3-propan-2-yl-3,4-diazabicyclo[4.1.0]hept-4-en-2-one is CC(C)N1N=CC2CC2C1=O.
What is the InChIKey of 3-propan-2-yl-3,4-diazabicyclo[4.1.0]hept-4-en-2-one?
The InChIKey is TXJHFZOTWGVRJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-5(2)10-8(11)7-3-6(7)4-9-10/h4-7H,3H2,1-2H3.
What are the key properties of 3-propan-2-yl-3,4-diazabicyclo[4.1.0]hept-4-en-2-one?
3-propan-2-yl-3,4-diazabicyclo[4.1.0]hept-4-en-2-one has a molecular weight of 152.20 g/mol, XLogP of 0.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-3,4-diazabicyclo[4.1.0]hept-4-en-2-one is sourced from PubChem (CID 68715981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).