C20H37N — CID 174325024
(2Z,4E)-5-(4-ethyl-2,2,3,3-tetramethylcyclobutyl)-7-methylnona-2,4-dien-2-amine (PubChem CID 174325024) has the molecular formula C20H37N and a molecular weight of 291.52 g/mol. Its IUPAC name is (2Z,4E)-5-(4-ethyl-2,2,3,3-tetramethylcyclobutyl)-7-methylnona-2,4-dien-2-amine.
| Compound Name | (2Z,4E)-5-(4-ethyl-2,2,3,3-tetramethylcyclobutyl)-7-methylnona-2,4-dien-2-amine |
|---|---|
| PubChem CID | 174325024 |
| Molecular Formula | C20H37N |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 291.29 |
| IUPAC Name | (2Z,4E)-5-(4-ethyl-2,2,3,3-tetramethylcyclobutyl)-7-methylnona-2,4-dien-2-amine |
| SMILES | CCC(C)C/C(=C\C=C(\C)N)C1C(CC)C(C)(C)C1(C)C |
| InChI | InChI=1S/C20H37N/c1-9-14(3)13-16(12-11-15(4)21)18-17(10-2)19(5,6)20(18,7)8/h11-12,14,17-18H,9-10,13,21H2,1-8H3/b15-11-,16-12+ |
| InChIKey | MISPLPFFBPPRIJ-UKVBVZPVSA-N |
| XLogP | 5.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|