C24H25N7 — CID 174325292
7-(1H-benzimidazol-2-yl)-5-[3-(diethylamino)propyl]-2,3-diethynylpyrrolo[2,3-b]pyrazin-6-amine (PubChem CID 174325292) has the molecular formula C24H25N7 and a molecular weight of 411.51 g/mol. Its IUPAC name is 7-(1H-benzimidazol-2-yl)-5-[3-(diethylamino)propyl]-2,3-diethynylpyrrolo[2,3-b]pyrazin-6-amine.
| Compound Name | 7-(1H-benzimidazol-2-yl)-5-[3-(diethylamino)propyl]-2,3-diethynylpyrrolo[2,3-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 174325292 |
| Molecular Formula | C24H25N7 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 7-(1H-benzimidazol-2-yl)-5-[3-(diethylamino)propyl]-2,3-diethynylpyrrolo[2,3-b]pyrazin-6-amine |
| SMILES | C#Cc1nc2c(-c3nc4ccccc4[nH]3)c(N)n(CCCN(CC)CC)c2nc1C#C |
| InChI | InChI=1S/C24H25N7/c1-5-16-17(6-2)29-24-21(26-16)20(23-27-18-12-9-10-13-19(18)28-23)22(25)31(24)15-11-14-30(7-3)8-4/h1-2,9-10,12-13H,7-8,11,14-15,25H2,3-4H3,(H,27,28) |
| InChIKey | ZGHUIKLIWLUCRJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|