C15H21NO4 — CID 174326517
phenylmethoxycarbonyl 3-amino-4,4-dimethylpentanoate (PubChem CID 174326517) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is phenylmethoxycarbonyl 3-amino-4,4-dimethylpentanoate.
| Compound Name | phenylmethoxycarbonyl 3-amino-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 174326517 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | phenylmethoxycarbonyl 3-amino-4,4-dimethylpentanoate |
| SMILES | CC(C)(C)C(N)CC(=O)OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H21NO4/c1-15(2,3)12(16)9-13(17)20-14(18)19-10-11-7-5-4-6-8-11/h4-8,12H,9-10,16H2,1-3H3 |
| InChIKey | BVJSXPFGEAOLLK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|