C17H23NO5 — CID 174379596
phenylmethoxycarbonyl (3S,4S)-4-amino-6-cyclopropyl-3-hydroxyhexanoate (PubChem CID 174379596) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is phenylmethoxycarbonyl (3S,4S)-4-amino-6-cyclopropyl-3-hydroxyhexanoate.
| Compound Name | phenylmethoxycarbonyl (3S,4S)-4-amino-6-cyclopropyl-3-hydroxyhexanoate |
|---|---|
| PubChem CID | 174379596 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | phenylmethoxycarbonyl (3S,4S)-4-amino-6-cyclopropyl-3-hydroxyhexanoate |
| SMILES | N[C@@H](CCC1CC1)[C@@H](O)CC(=O)OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H23NO5/c18-14(9-8-12-6-7-12)15(19)10-16(20)23-17(21)22-11-13-4-2-1-3-5-13/h1-5,12,14-15,19H,6-11,18H2/t14-,15-/m0/s1 |
| InChIKey | RKWSDUYUVZLSHS-GJZGRUSLSA-N |
| XLogP | 2.13 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|