C11H12I2O2S — CID 174329953
1-(4,4-diiodobut-2-enylsulfonyl)-4-methylbenzene (PubChem CID 174329953) has the molecular formula C11H12I2O2S and a molecular weight of 462.09 g/mol. Its IUPAC name is 1-(4,4-diiodobut-2-enylsulfonyl)-4-methylbenzene.
| Compound Name | 1-(4,4-diiodobut-2-enylsulfonyl)-4-methylbenzene |
|---|---|
| PubChem CID | 174329953 |
| Molecular Formula | C11H12I2O2S |
| Molecular Weight | 462.09 g/mol |
| Exact Mass | 461.86 |
| IUPAC Name | 1-(4,4-diiodobut-2-enylsulfonyl)-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)CC=CC(I)I)cc1 |
| InChI | InChI=1S/C11H12I2O2S/c1-9-4-6-10(7-5-9)16(14,15)8-2-3-11(12)13/h2-7,11H,8H2,1H3 |
| InChIKey | NIXLQXBGUPXNML-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.09 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|