C22H20F3N3O3S — CID 17433764
N-(1-pyridin-4-ylethyl)-2-[4-[[3-(trifluoromethyl)phenyl]sulfonylamino]phenyl]acetamide (PubChem CID 17433764) has the molecular formula C22H20F3N3O3S and a molecular weight of 463.48 g/mol. Its IUPAC name is N-(1-pyridin-4-ylethyl)-2-[4-[[3-(trifluoromethyl)phenyl]sulfonylamino]phenyl]acetamide.
| Compound Name | N-(1-pyridin-4-ylethyl)-2-[4-[[3-(trifluoromethyl)phenyl]sulfonylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 17433764 |
| Molecular Formula | C22H20F3N3O3S |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | N-(1-pyridin-4-ylethyl)-2-[4-[[3-(trifluoromethyl)phenyl]sulfonylamino]phenyl]acetamide |
| SMILES | CC(NC(=O)Cc1ccc(NS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1)c1ccncc1 |
| InChI | InChI=1S/C22H20F3N3O3S/c1-15(17-9-11-26-12-10-17)27-21(29)13-16-5-7-19(8-6-16)28-32(30,31)20-4-2-3-18(14-20)22(23,24)25/h2-12,14-15,28H,13H2,1H3,(H,27,29) |
| InChIKey | LWXZLEFWUULOJR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |