About dipotassium;dimethyl 2-methylidenebutanedioate;hydride
dipotassium;dimethyl 2-methylidenebutanedioate;hydride (PubChem CID 174338040) has the molecular formula C7H12K2O4
and a molecular weight of 238.36 g/mol. Its IUPAC name is dipotassium;dimethyl 2-methylidenebutanedioate;hydride.
Molecular Properties
| Compound Name | dipotassium;dimethyl 2-methylidenebutanedioate;hydride |
| PubChem CID | 174338040 |
| Molecular Formula | C7H12K2O4 |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | dipotassium;dimethyl 2-methylidenebutanedioate;hydride |
| SMILES | C=C(CC(=O)OC)C(=O)OC.[H-].[H-].[K+].[K+] |
| InChI | InChI=1S/C7H10O4.2K.2H/c1-5(7(9)11-3)4-6(8)10-2;;;;/h1,4H2,2-3H3;;;;/q;2*+1;2*-1 |
| InChIKey | YHLAVHILFLWPTJ-UHFFFAOYSA-N |
| XLogP | -5.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | -5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;dimethyl 2-methylidenebutanedioate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;dimethyl 2-methylidenebutanedioate;hydride?
The IUPAC name of dipotassium;dimethyl 2-methylidenebutanedioate;hydride (CID 174338040) is dipotassium;dimethyl 2-methylidenebutanedioate;hydride.
What is the SMILES notation for dipotassium;dimethyl 2-methylidenebutanedioate;hydride?
The canonical SMILES for dipotassium;dimethyl 2-methylidenebutanedioate;hydride is C=C(CC(=O)OC)C(=O)OC.[H-].[H-].[K+].[K+].
What is the InChIKey of dipotassium;dimethyl 2-methylidenebutanedioate;hydride?
The InChIKey is YHLAVHILFLWPTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4.2K.2H/c1-5(7(9)11-3)4-6(8)10-2;;;;/h1,4H2,2-3H3;;;;/q;2*+1;2*-1.
What are the key properties of dipotassium;dimethyl 2-methylidenebutanedioate;hydride?
dipotassium;dimethyl 2-methylidenebutanedioate;hydride has a molecular weight of 238.36 g/mol, XLogP of -5.49, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;dimethyl 2-methylidenebutanedioate;hydride is sourced from PubChem (CID 174338040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).