About dimethyl 2-methylidenebutanedioate;styrene
dimethyl 2-methylidenebutanedioate;styrene (PubChem CID 22357357) has the molecular formula C15H18O4
and a molecular weight of 262.31 g/mol. Its IUPAC name is dimethyl 2-methylidenebutanedioate;styrene.
Molecular Properties
| Compound Name | dimethyl 2-methylidenebutanedioate;styrene |
| PubChem CID | 22357357 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | dimethyl 2-methylidenebutanedioate;styrene |
| SMILES | C=C(CC(=O)OC)C(=O)OC.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C7H10O4/c1-2-8-6-4-3-5-7-8;1-5(7(9)11-3)4-6(8)10-2/h2-7H,1H2;1,4H2,2-3H3 |
| InChIKey | DLUVGNMHNMKJIX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-methylidenebutanedioate;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-methylidenebutanedioate;styrene?
The IUPAC name of dimethyl 2-methylidenebutanedioate;styrene (CID 22357357) is dimethyl 2-methylidenebutanedioate;styrene.
What is the SMILES notation for dimethyl 2-methylidenebutanedioate;styrene?
The canonical SMILES for dimethyl 2-methylidenebutanedioate;styrene is C=C(CC(=O)OC)C(=O)OC.C=Cc1ccccc1.
What is the InChIKey of dimethyl 2-methylidenebutanedioate;styrene?
The InChIKey is DLUVGNMHNMKJIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C7H10O4/c1-2-8-6-4-3-5-7-8;1-5(7(9)11-3)4-6(8)10-2/h2-7H,1H2;1,4H2,2-3H3.
What are the key properties of dimethyl 2-methylidenebutanedioate;styrene?
dimethyl 2-methylidenebutanedioate;styrene has a molecular weight of 262.31 g/mol, XLogP of 2.61, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-methylidenebutanedioate;styrene is sourced from PubChem (CID 22357357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).