C13H28N4O4 — CID 131738461
N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dimethyl 2-methylidenebutanedioate (PubChem CID 131738461) has the molecular formula C13H28N4O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dimethyl 2-methylidenebutanedioate.
| Compound Name | N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dimethyl 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 131738461 |
| Molecular Formula | C13H28N4O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | N',N'-bis(2-aminoethyl)ethane-1,2-diamine;dimethyl 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC)C(=O)OC.NCCN(CCN)CCN |
| InChI | InChI=1S/C7H10O4.C6H18N4/c1-5(7(9)11-3)4-6(8)10-2;7-1-4-10(5-2-8)6-3-9/h1,4H2,2-3H3;1-9H2 |
| InChIKey | YYIKBRQODYYQBS-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 133.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|