C17H14IP — CID 174339767
cyclopenta-2,4-dien-1-ylidene-iodo-diphenyl-λ5-phosphane (PubChem CID 174339767) has the molecular formula C17H14IP and a molecular weight of 376.18 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-ylidene-iodo-diphenyl-λ5-phosphane.
| Compound Name | cyclopenta-2,4-dien-1-ylidene-iodo-diphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 174339767 |
| Molecular Formula | C17H14IP |
| Molecular Weight | 376.18 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | cyclopenta-2,4-dien-1-ylidene-iodo-diphenyl-λ5-phosphane |
| SMILES | IP(=C1C=CC=C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H14IP/c18-19(17-13-7-8-14-17,15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H |
| InChIKey | GGCSHUIZIPASLH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.18 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|