C31H40O3 — CID 174340418
(8S,9S,10R,13S,14S)-10,13-dimethyl-17-(3-methyl-1-oxo-3-phenylbutan-2-yl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carboxylic acid (PubChem CID 174340418) has the molecular formula C31H40O3 and a molecular weight of 460.66 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-10,13-dimethyl-17-(3-methyl-1-oxo-3-phenylbutan-2-yl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carboxylic acid.
| Compound Name | (8S,9S,10R,13S,14S)-10,13-dimethyl-17-(3-methyl-1-oxo-3-phenylbutan-2-yl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carboxylic acid |
|---|---|
| PubChem CID | 174340418 |
| Molecular Formula | C31H40O3 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | (8S,9S,10R,13S,14S)-10,13-dimethyl-17-(3-methyl-1-oxo-3-phenylbutan-2-yl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carboxylic acid |
| SMILES | CC(C)(c1ccccc1)C(C=O)C1CC[C@H]2[C@@H]3CC=C4C=C(C(=O)O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H40O3/c1-29(2,21-8-6-5-7-9-21)27(19-32)26-13-12-24-23-11-10-22-18-20(28(33)34)14-16-30(22,3)25(23)15-17-31(24,26)4/h5-10,18-19,23-27H,11-17H2,1-4H3,(H,33,34)/t23-,24-,25-,26?,27?,30-,31-/m0/s1 |
| InChIKey | WEEYLFPACZXOHN-HUAQCJCISA-N |
| XLogP | 6.98 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|