C24H50N2O — CID 174340568
N-(6,6-dimethylheptyl)-1-[2-(5,5-dimethylhexoxy)ethyl]piperidin-3-amine (PubChem CID 174340568) has the molecular formula C24H50N2O and a molecular weight of 382.68 g/mol. Its IUPAC name is N-(6,6-dimethylheptyl)-1-[2-(5,5-dimethylhexoxy)ethyl]piperidin-3-amine.
| Compound Name | N-(6,6-dimethylheptyl)-1-[2-(5,5-dimethylhexoxy)ethyl]piperidin-3-amine |
|---|---|
| PubChem CID | 174340568 |
| Molecular Formula | C24H50N2O |
| Molecular Weight | 382.68 g/mol |
| Exact Mass | 382.39 |
| IUPAC Name | N-(6,6-dimethylheptyl)-1-[2-(5,5-dimethylhexoxy)ethyl]piperidin-3-amine |
| SMILES | CC(C)(C)CCCCCNC1CCCN(CCOCCCCC(C)(C)C)C1 |
| InChI | InChI=1S/C24H50N2O/c1-23(2,3)14-8-7-10-16-25-22-13-12-17-26(21-22)18-20-27-19-11-9-15-24(4,5)6/h22,25H,7-21H2,1-6H3 |
| InChIKey | VKJHQMYGWFXFSM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.68 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|