C39H3F18N9 — CID 174342187
2-[[2,3-bis[cyano-[2,6-dicyano-3,4-bis(trifluoromethyl)phenyl]methylidene]cyclopropylidene]-cyanomethyl]-4,5-bis(trifluoromethyl)benzene-1,3-dicarbonitrile (PubChem CID 174342187) has the molecular formula C39H3F18N9 and a molecular weight of 939.48 g/mol. Its IUPAC name is 2-[[2,3-bis[cyano-[2,6-dicyano-3,4-bis(trifluoromethyl)phenyl]methylidene]cyclopropylidene]-cyanomethyl]-4,5-bis(trifluoromethyl)benzene-1,3-dicarbonitrile.
| Compound Name | 2-[[2,3-bis[cyano-[2,6-dicyano-3,4-bis(trifluoromethyl)phenyl]methylidene]cyclopropylidene]-cyanomethyl]-4,5-bis(trifluoromethyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 174342187 |
| Molecular Formula | C39H3F18N9 |
| Molecular Weight | 939.48 g/mol |
| Exact Mass | 939.02 |
| IUPAC Name | 2-[[2,3-bis[cyano-[2,6-dicyano-3,4-bis(trifluoromethyl)phenyl]methylidene]cyclopropylidene]-cyanomethyl]-4,5-bis(trifluoromethyl)benzene-1,3-dicarbonitrile |
| SMILES | N#CC(=C1C(=C(C#N)c2c(C#N)cc(C(F)(F)F)c(C(F)(F)F)c2C#N)C1=C(C#N)c1c(C#N)cc(C(F)(F)F)c(C(F)(F)F)c1C#N)c1c(C#N)cc(C(F)(F)F)c(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C39H3F18N9/c40-34(41,42)22-1-13(4-58)25(19(10-64)31(22)37(49,50)51)16(7-61)28-29(17(8-62)26-14(5-59)2-23(35(43,44)45)32(20(26)11-65)38(52,53)54)30(28)18(9-63)27-15(6-60)3-24(36(46,47)48)33(21(27)12-66)39(55,56)57/h1-3H/b28-16-,29-17-,30-18- |
| InChIKey | LEODWIRNCSMBNQ-GRPVWXCKSA-N |
| XLogP | 11.28 |
| TPSA | 214.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.48 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|