C15H18FN5O4S — CID 174342784
[(2R)-2,3-dihydroxy-3-methylbutyl] (2Z)-3-(3-cyano-4-fluorophenyl)imino-3-(hydroxyamino)-2-hydroxyiminopropanimidothioate (PubChem CID 174342784) has the molecular formula C15H18FN5O4S and a molecular weight of 383.41 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxy-3-methylbutyl] (2Z)-3-(3-cyano-4-fluorophenyl)imino-3-(hydroxyamino)-2-hydroxyiminopropanimidothioate.
| Compound Name | [(2R)-2,3-dihydroxy-3-methylbutyl] (2Z)-3-(3-cyano-4-fluorophenyl)imino-3-(hydroxyamino)-2-hydroxyiminopropanimidothioate |
|---|---|
| PubChem CID | 174342784 |
| Molecular Formula | C15H18FN5O4S |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | [(2R)-2,3-dihydroxy-3-methylbutyl] (2Z)-3-(3-cyano-4-fluorophenyl)imino-3-(hydroxyamino)-2-hydroxyiminopropanimidothioate |
| SMILES | [H]/N=C(SC[C@H](O)C(C)(C)O)/C(=N\O)C(=N/c1ccc(F)c(C#N)c1)/NO |
| InChI | InChI=1S/C15H18FN5O4S/c1-15(2,23)11(22)7-26-13(18)12(20-24)14(21-25)19-9-3-4-10(16)8(5-9)6-17/h3-5,11,18,22-25H,7H2,1-2H3,(H,19,21)/b18-13-,20-12+/t11-/m0/s1 |
| InChIKey | VRELUFUDNFRIJP-GIYMKPMTSA-N |
| XLogP | 1.38 |
| TPSA | 165.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|