C24H29F2N5O6 — CID 174344081
(2R,3R,4S,5R)-2-[6-[[4-(difluoromethoxy)phenyl]methoxy]-8-[(4-hydroxycyclohexyl)amino]purin-9-yl]-5-methyloxolane-3,4-diol (PubChem CID 174344081) has the molecular formula C24H29F2N5O6 and a molecular weight of 521.52 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-[[4-(difluoromethoxy)phenyl]methoxy]-8-[(4-hydroxycyclohexyl)amino]purin-9-yl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-[[4-(difluoromethoxy)phenyl]methoxy]-8-[(4-hydroxycyclohexyl)amino]purin-9-yl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 174344081 |
| Molecular Formula | C24H29F2N5O6 |
| Molecular Weight | 521.52 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-[[4-(difluoromethoxy)phenyl]methoxy]-8-[(4-hydroxycyclohexyl)amino]purin-9-yl]-5-methyloxolane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](n2c(NC3CCC(O)CC3)nc3c(OCc4ccc(OC(F)F)cc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H29F2N5O6/c1-12-18(33)19(34)22(36-12)31-20-17(30-24(31)29-14-4-6-15(32)7-5-14)21(28-11-27-20)35-10-13-2-8-16(9-3-13)37-23(25)26/h2-3,8-9,11-12,14-15,18-19,22-23,32-34H,4-7,10H2,1H3,(H,29,30)/t12-,14?,15?,18-,19-,22-/m1/s1 |
| InChIKey | JXRSQJHSUIPZFE-RTKYIEJRSA-N |
| XLogP | 2.36 |
| TPSA | 144.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |