C23H24F2N6O4 — CID 171816609
4-[[8-[[(1R)-3,3-difluorocyclopentyl]amino]-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]purin-6-yl]oxymethyl]benzonitrile (PubChem CID 171816609) has the molecular formula C23H24F2N6O4 and a molecular weight of 486.48 g/mol. Its IUPAC name is 4-[[8-[[(1R)-3,3-difluorocyclopentyl]amino]-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]purin-6-yl]oxymethyl]benzonitrile.
| Compound Name | 4-[[8-[[(1R)-3,3-difluorocyclopentyl]amino]-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]purin-6-yl]oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 171816609 |
| Molecular Formula | C23H24F2N6O4 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 4-[[8-[[(1R)-3,3-difluorocyclopentyl]amino]-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]purin-6-yl]oxymethyl]benzonitrile |
| SMILES | C[C@H]1O[C@@H](n2c(N[C@@H]3CCC(F)(F)C3)nc3c(OCc4ccc(C#N)cc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H24F2N6O4/c1-12-17(32)18(33)21(35-12)31-19-16(30-22(31)29-15-6-7-23(24,25)8-15)20(28-11-27-19)34-10-14-4-2-13(9-26)3-5-14/h2-5,11-12,15,17-18,21,32-33H,6-8,10H2,1H3,(H,29,30)/t12-,15-,17-,18-,21-/m1/s1 |
| InChIKey | WETIXASKZAXALW-UMGDAMFDSA-N |
| XLogP | 2.52 |
| TPSA | 138.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |