C25H23Cl2N7O4 — CID 57469398
4-[[(2R,3R,4R,5R)-5-[6-amino-8-[(3,4-dichlorophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl]benzonitrile (PubChem CID 57469398) has the molecular formula C25H23Cl2N7O4 and a molecular weight of 556.41 g/mol. Its IUPAC name is 4-[[(2R,3R,4R,5R)-5-[6-amino-8-[(3,4-dichlorophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl]benzonitrile.
| Compound Name | 4-[[(2R,3R,4R,5R)-5-[6-amino-8-[(3,4-dichlorophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl]benzonitrile |
|---|---|
| PubChem CID | 57469398 |
| Molecular Formula | C25H23Cl2N7O4 |
| Molecular Weight | 556.41 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | 4-[[(2R,3R,4R,5R)-5-[6-amino-8-[(3,4-dichlorophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl]benzonitrile |
| SMILES | N#Cc1ccc(COC[C@H]2O[C@@H](n3c(NCc4ccc(Cl)c(Cl)c4)nc4c(N)ncnc43)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C25H23Cl2N7O4/c26-16-6-5-15(7-17(16)27)9-30-25-33-19-22(29)31-12-32-23(19)34(25)24-21(36)20(35)18(38-24)11-37-10-14-3-1-13(8-28)2-4-14/h1-7,12,18,20-21,24,35-36H,9-11H2,(H,30,33)(H2,29,31,32)/t18-,20+,21-,24-/m1/s1 |
| InChIKey | ZXGGCBQORXDVTE-LOCCHRAXSA-N |
| XLogP | 3.04 |
| TPSA | 164.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |