C31H30F3N7O4 — CID 25257427
9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[[4-(trifluoromethyl)phenyl]methoxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-8-N-(quinolin-6-ylmethyl)purine-6,8-diamine (PubChem CID 25257427) has the molecular formula C31H30F3N7O4 and a molecular weight of 621.62 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[[4-(trifluoromethyl)phenyl]methoxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-8-N-(quinolin-6-ylmethyl)purine-6,8-diamine.
| Compound Name | 9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[[4-(trifluoromethyl)phenyl]methoxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-8-N-(quinolin-6-ylmethyl)purine-6,8-diamine |
|---|---|
| PubChem CID | 25257427 |
| Molecular Formula | C31H30F3N7O4 |
| Molecular Weight | 621.62 g/mol |
| Exact Mass | 621.23 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[[4-(trifluoromethyl)phenyl]methoxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-8-N-(quinolin-6-ylmethyl)purine-6,8-diamine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COCc1ccc(C(F)(F)F)cc1)O[C@H]2n1c(NCc2ccc3ncccc3c2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C31H30F3N7O4/c1-30(2)44-24-22(15-42-14-17-5-8-20(9-6-17)31(32,33)34)43-28(25(24)45-30)41-27-23(26(35)38-16-39-27)40-29(41)37-13-18-7-10-21-19(12-18)4-3-11-36-21/h3-12,16,22,24-25,28H,13-15H2,1-2H3,(H,37,40)(H2,35,38,39)/t22-,24-,25-,28-/m1/s1 |
| InChIKey | CUCLVAMUMLDBDQ-ZYWWQZICSA-N |
| XLogP | 5.22 |
| TPSA | 131.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |